(6-methoxypyridin-3-yl)(3-phenoxypyrrolidin-1-yl)methanone
Chemical Structure Depiction of
(6-methoxypyridin-3-yl)(3-phenoxypyrrolidin-1-yl)methanone
(6-methoxypyridin-3-yl)(3-phenoxypyrrolidin-1-yl)methanone
Compound characteristics
| Compound ID: | S512-0166 |
| Compound Name: | (6-methoxypyridin-3-yl)(3-phenoxypyrrolidin-1-yl)methanone |
| Molecular Weight: | 298.34 |
| Molecular Formula: | C17 H18 N2 O3 |
| Smiles: | COc1ccc(cn1)C(N1CCC(C1)Oc1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.3433 |
| logD: | 2.3433 |
| logSw: | -2.2515 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 40.029 |
| InChI Key: | GFEFLEAGODIQAK-OAHLLOKOSA-N |