N-[3-(4-ethylpiperazin-1-yl)propyl]-1-methyl-7-oxoazepane-2-carboxamide
Chemical Structure Depiction of
N-[3-(4-ethylpiperazin-1-yl)propyl]-1-methyl-7-oxoazepane-2-carboxamide
N-[3-(4-ethylpiperazin-1-yl)propyl]-1-methyl-7-oxoazepane-2-carboxamide
Compound characteristics
| Compound ID: | S513-0124 |
| Compound Name: | N-[3-(4-ethylpiperazin-1-yl)propyl]-1-methyl-7-oxoazepane-2-carboxamide |
| Molecular Weight: | 324.47 |
| Molecular Formula: | C17 H32 N4 O2 |
| Smiles: | CCN1CCN(CCCNC(C2CCCCC(N2C)=O)=O)CC1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | -0.2765 |
| logD: | -1.2247 |
| logSw: | -0.5799 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.791 |
| InChI Key: | DIISHYPXRVODHB-HNNXBMFYSA-N |