2-ethyl-N-(4-methylphenyl)-7-oxoazepane-2-carboxamide
Chemical Structure Depiction of
2-ethyl-N-(4-methylphenyl)-7-oxoazepane-2-carboxamide
2-ethyl-N-(4-methylphenyl)-7-oxoazepane-2-carboxamide
Compound characteristics
| Compound ID: | S515-0296 |
| Compound Name: | 2-ethyl-N-(4-methylphenyl)-7-oxoazepane-2-carboxamide |
| Molecular Weight: | 274.36 |
| Molecular Formula: | C16 H22 N2 O2 |
| Smiles: | CCC1(CCCCC(N1)=O)C(Nc1ccc(C)cc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.5125 |
| logD: | 2.5125 |
| logSw: | -2.8682 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 49.704 |
| InChI Key: | XBYVNTUGWZYOFZ-INIZCTEOSA-N |