2-(2-methoxyethyl)-7-oxoazepane-2-carboxylic acid
Chemical Structure Depiction of
2-(2-methoxyethyl)-7-oxoazepane-2-carboxylic acid
2-(2-methoxyethyl)-7-oxoazepane-2-carboxylic acid
Compound characteristics
| Compound ID: | S515-0554 |
| Compound Name: | 2-(2-methoxyethyl)-7-oxoazepane-2-carboxylic acid |
| Molecular Weight: | 215.25 |
| Molecular Formula: | C10 H17 N O4 |
| Smiles: | COCCC1(CCCCC(N1)=O)C(O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | -0.3185 |
| logD: | -3.494 |
| logSw: | -0.5088 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.364 |
| InChI Key: | PVBKMQGYYHKCET-SNVBAGLBSA-N |