(2,5-difluorophenyl){2-[(4-methylpiperidin-1-yl)methyl]azepan-1-yl}methanone
Chemical Structure Depiction of
(2,5-difluorophenyl){2-[(4-methylpiperidin-1-yl)methyl]azepan-1-yl}methanone
(2,5-difluorophenyl){2-[(4-methylpiperidin-1-yl)methyl]azepan-1-yl}methanone
Compound characteristics
| Compound ID: | S534-0605 |
| Compound Name: | (2,5-difluorophenyl){2-[(4-methylpiperidin-1-yl)methyl]azepan-1-yl}methanone |
| Molecular Weight: | 350.45 |
| Molecular Formula: | C20 H28 F2 N2 O |
| Smiles: | CC1CCN(CC1)CC1CCCCCN1C(c1cc(ccc1F)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1397 |
| logD: | 3.6866 |
| logSw: | -4.1124 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 20.5965 |
| InChI Key: | NNTGFAKKBZVHRL-QGZVFWFLSA-N |