N-cyclopropyl-N-[9-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-1-oxa-9-azaspiro[5.5]undecan-4-yl]-N'-ethylurea
Chemical Structure Depiction of
N-cyclopropyl-N-[9-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-1-oxa-9-azaspiro[5.5]undecan-4-yl]-N'-ethylurea
N-cyclopropyl-N-[9-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-1-oxa-9-azaspiro[5.5]undecan-4-yl]-N'-ethylurea
Compound characteristics
| Compound ID: | S543-0441 |
| Compound Name: | N-cyclopropyl-N-[9-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-1-oxa-9-azaspiro[5.5]undecan-4-yl]-N'-ethylurea |
| Molecular Weight: | 420.57 |
| Molecular Formula: | C21 H32 N4 O3 S |
| Smiles: | CCNC(N(C1CC1)C1CCOC2(CCN(CC2)C(c2c(C)nc(C)s2)=O)C1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.4518 |
| logD: | 2.4516 |
| logSw: | -2.5029 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.593 |
| InChI Key: | AMEBHIQOPUEYMH-QGZVFWFLSA-N |