(1,5-dimethyl-1H-pyrazol-3-yl)[3-(2-phenoxyethyl)pyrrolidin-1-yl]methanone
Chemical Structure Depiction of
(1,5-dimethyl-1H-pyrazol-3-yl)[3-(2-phenoxyethyl)pyrrolidin-1-yl]methanone
(1,5-dimethyl-1H-pyrazol-3-yl)[3-(2-phenoxyethyl)pyrrolidin-1-yl]methanone
Compound characteristics
| Compound ID: | S544-0018 |
| Compound Name: | (1,5-dimethyl-1H-pyrazol-3-yl)[3-(2-phenoxyethyl)pyrrolidin-1-yl]methanone |
| Molecular Weight: | 313.4 |
| Molecular Formula: | C18 H23 N3 O2 |
| Smiles: | Cc1cc(C(N2CCC(CCOc3ccccc3)C2)=O)nn1C |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.5576 |
| logD: | 2.5576 |
| logSw: | -2.6559 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 38.819 |
| InChI Key: | YLZCRIZANWPYKW-HNNXBMFYSA-N |