N-(2-{3-[2-(2-fluorophenoxy)ethyl]pyrrolidin-1-yl}-2-oxoethyl)-N,3-dimethyl-2-oxo-2,3-dihydro-1,3-benzoxazole-6-sulfonamide
Chemical Structure Depiction of
N-(2-{3-[2-(2-fluorophenoxy)ethyl]pyrrolidin-1-yl}-2-oxoethyl)-N,3-dimethyl-2-oxo-2,3-dihydro-1,3-benzoxazole-6-sulfonamide
N-(2-{3-[2-(2-fluorophenoxy)ethyl]pyrrolidin-1-yl}-2-oxoethyl)-N,3-dimethyl-2-oxo-2,3-dihydro-1,3-benzoxazole-6-sulfonamide
Compound characteristics
| Compound ID: | S544-1121 |
| Compound Name: | N-(2-{3-[2-(2-fluorophenoxy)ethyl]pyrrolidin-1-yl}-2-oxoethyl)-N,3-dimethyl-2-oxo-2,3-dihydro-1,3-benzoxazole-6-sulfonamide |
| Molecular Weight: | 491.54 |
| Molecular Formula: | C23 H26 F N3 O6 S |
| Smiles: | CN1C(=O)Oc2cc(ccc12)S(N(C)CC(N1CCC(CCOc2ccccc2F)C1)=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.6296 |
| logD: | 2.6296 |
| logSw: | -3.2038 |
| Hydrogen bond acceptors count: | 11 |
| Polar surface area: | 79.593 |
| InChI Key: | RLBTXRVKMWPGEX-INIZCTEOSA-N |