{3-[2-(2-fluorophenoxy)ethyl]pyrrolidin-1-yl}[1-(morpholine-4-sulfonyl)piperidin-4-yl]methanone
Chemical Structure Depiction of
{3-[2-(2-fluorophenoxy)ethyl]pyrrolidin-1-yl}[1-(morpholine-4-sulfonyl)piperidin-4-yl]methanone
{3-[2-(2-fluorophenoxy)ethyl]pyrrolidin-1-yl}[1-(morpholine-4-sulfonyl)piperidin-4-yl]methanone
Compound characteristics
| Compound ID: | S544-1134 |
| Compound Name: | {3-[2-(2-fluorophenoxy)ethyl]pyrrolidin-1-yl}[1-(morpholine-4-sulfonyl)piperidin-4-yl]methanone |
| Molecular Weight: | 469.57 |
| Molecular Formula: | C22 H32 F N3 O5 S |
| Smiles: | C1CN(CC1CCOc1ccccc1F)C(C1CCN(CC1)S(N1CCOCC1)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.0206 |
| logD: | 2.0206 |
| logSw: | -2.3442 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 66.444 |
| InChI Key: | XRYOIWLRJQWYKP-SFHVURJKSA-N |