1-[2-(3-methyl-1,2,4-oxadiazol-5-yl)azepan-1-yl]-2-phenylethan-1-one
Chemical Structure Depiction of
1-[2-(3-methyl-1,2,4-oxadiazol-5-yl)azepan-1-yl]-2-phenylethan-1-one
1-[2-(3-methyl-1,2,4-oxadiazol-5-yl)azepan-1-yl]-2-phenylethan-1-one
Compound characteristics
| Compound ID: | S545-0038 |
| Compound Name: | 1-[2-(3-methyl-1,2,4-oxadiazol-5-yl)azepan-1-yl]-2-phenylethan-1-one |
| Molecular Weight: | 299.37 |
| Molecular Formula: | C17 H21 N3 O2 |
| Smiles: | Cc1nc(C2CCCCCN2C(Cc2ccccc2)=O)on1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.9397 |
| logD: | 2.9397 |
| logSw: | -2.9615 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 47.674 |
| InChI Key: | UKICVJGFJRXLOM-HNNXBMFYSA-N |