(furan-3-yl)[2-(3-methyl-1,2,4-oxadiazol-5-yl)azepan-1-yl]methanone
Chemical Structure Depiction of
(furan-3-yl)[2-(3-methyl-1,2,4-oxadiazol-5-yl)azepan-1-yl]methanone
(furan-3-yl)[2-(3-methyl-1,2,4-oxadiazol-5-yl)azepan-1-yl]methanone
Compound characteristics
| Compound ID: | S545-0113 |
| Compound Name: | (furan-3-yl)[2-(3-methyl-1,2,4-oxadiazol-5-yl)azepan-1-yl]methanone |
| Molecular Weight: | 275.3 |
| Molecular Formula: | C14 H17 N3 O3 |
| Smiles: | Cc1nc(C2CCCCCN2C(c2ccoc2)=O)on1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.1912 |
| logD: | 2.1912 |
| logSw: | -2.2365 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 56.005 |
| InChI Key: | ASCFVEVNMCPUKR-LBPRGKRZSA-N |