[2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)azepan-1-yl][1-(4-methoxyphenyl)cyclopropyl]methanone
Chemical Structure Depiction of
[2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)azepan-1-yl][1-(4-methoxyphenyl)cyclopropyl]methanone
[2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)azepan-1-yl][1-(4-methoxyphenyl)cyclopropyl]methanone
Compound characteristics
| Compound ID: | S545-0302 |
| Compound Name: | [2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)azepan-1-yl][1-(4-methoxyphenyl)cyclopropyl]methanone |
| Molecular Weight: | 381.47 |
| Molecular Formula: | C22 H27 N3 O3 |
| Smiles: | COc1ccc(cc1)C1(CC1)C(N1CCCCCC1c1nc(C2CC2)no1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.2588 |
| logD: | 4.2588 |
| logSw: | -4.1264 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 56.636 |
| InChI Key: | JHECTMOZCWHYIF-SFHVURJKSA-N |