1-{2-[3-(pyridin-4-yl)-1,2,4-oxadiazol-5-yl]azepan-1-yl}ethan-1-one
Chemical Structure Depiction of
1-{2-[3-(pyridin-4-yl)-1,2,4-oxadiazol-5-yl]azepan-1-yl}ethan-1-one
1-{2-[3-(pyridin-4-yl)-1,2,4-oxadiazol-5-yl]azepan-1-yl}ethan-1-one
Compound characteristics
| Compound ID: | S545-0657 |
| Compound Name: | 1-{2-[3-(pyridin-4-yl)-1,2,4-oxadiazol-5-yl]azepan-1-yl}ethan-1-one |
| Molecular Weight: | 286.33 |
| Molecular Formula: | C15 H18 N4 O2 |
| Smiles: | CC(N1CCCCCC1c1nc(c2ccncc2)no1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.1911 |
| logD: | 2.191 |
| logSw: | -1.9578 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 58.485 |
| InChI Key: | GZAQFXRBZUBKMH-ZDUSSCGKSA-N |