3-(3-chlorophenyl)-5-(1H-pyrrol-2-yl)-1,2,4-oxadiazole
Chemical Structure Depiction of
3-(3-chlorophenyl)-5-(1H-pyrrol-2-yl)-1,2,4-oxadiazole
3-(3-chlorophenyl)-5-(1H-pyrrol-2-yl)-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | S553-0091 |
| Compound Name: | 3-(3-chlorophenyl)-5-(1H-pyrrol-2-yl)-1,2,4-oxadiazole |
| Molecular Weight: | 245.67 |
| Molecular Formula: | C12 H8 Cl N3 O |
| Smiles: | c1cc(cc(c1)[Cl])c1nc(c2ccc[nH]2)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.024 |
| logD: | 4.024 |
| logSw: | -4.462 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.71 |
| InChI Key: | XDEPCBGJWQLGES-UHFFFAOYSA-N |