N-{[6-(4-methoxyphenyl)[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}furan-3-carboxamide
Chemical Structure Depiction of
N-{[6-(4-methoxyphenyl)[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}furan-3-carboxamide
N-{[6-(4-methoxyphenyl)[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}furan-3-carboxamide
Compound characteristics
| Compound ID: | S554-0683 |
| Compound Name: | N-{[6-(4-methoxyphenyl)[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl}furan-3-carboxamide |
| Molecular Weight: | 349.35 |
| Molecular Formula: | C18 H15 N5 O3 |
| Smiles: | COc1ccc(cc1)c1ccc2nnc(CNC(c3ccoc3)=O)n2n1 |
| Stereo: | ACHIRAL |
| logP: | 1.9006 |
| logD: | 1.9006 |
| logSw: | -2.3288 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.134 |
| InChI Key: | ITSKEURYWGRWIA-UHFFFAOYSA-N |