(2,6-dimethoxypyridin-3-yl)(9-hydroxy-9-{[methyl(propyl)amino]methyl}-3-azaspiro[5.5]undecan-3-yl)methanone
					Chemical Structure Depiction of
(2,6-dimethoxypyridin-3-yl)(9-hydroxy-9-{[methyl(propyl)amino]methyl}-3-azaspiro[5.5]undecan-3-yl)methanone
			(2,6-dimethoxypyridin-3-yl)(9-hydroxy-9-{[methyl(propyl)amino]methyl}-3-azaspiro[5.5]undecan-3-yl)methanone
Compound characteristics
| Compound ID: | S567-0527 | 
| Compound Name: | (2,6-dimethoxypyridin-3-yl)(9-hydroxy-9-{[methyl(propyl)amino]methyl}-3-azaspiro[5.5]undecan-3-yl)methanone | 
| Molecular Weight: | 419.56 | 
| Molecular Formula: | C23 H37 N3 O4 | 
| Smiles: | CCCN(C)CC1(CCC2(CC1)CCN(CC2)C(c1ccc(nc1OC)OC)=O)O | 
| Stereo: | ACHIRAL | 
| logP: | 2.6916 | 
| logD: | 1.289 | 
| logSw: | -2.7278 | 
| Hydrogen bond acceptors count: | 7 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 60.836 | 
| InChI Key: | WMPJMMLTEHZAHE-UHFFFAOYSA-N | 
 
				 
				