phenyl[3-(1H-tetrazol-5-yl)piperidin-1-yl]methanone
Chemical Structure Depiction of
phenyl[3-(1H-tetrazol-5-yl)piperidin-1-yl]methanone
phenyl[3-(1H-tetrazol-5-yl)piperidin-1-yl]methanone
Compound characteristics
| Compound ID: | S569-0337 |
| Compound Name: | phenyl[3-(1H-tetrazol-5-yl)piperidin-1-yl]methanone |
| Molecular Weight: | 257.29 |
| Molecular Formula: | C13 H15 N5 O |
| Smiles: | C1CC(CN(C1)C(c1ccccc1)=O)c1nnn[nH]1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.8653 |
| logD: | -0.8813 |
| logSw: | -1.666 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.933 |
| InChI Key: | ANZCTCZHTFSUEH-NSHDSACASA-N |