1-(4-methoxyphenyl)-N-[(2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridin-4a-yl)methyl]cyclopropane-1-carboxamide
Chemical Structure Depiction of
1-(4-methoxyphenyl)-N-[(2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridin-4a-yl)methyl]cyclopropane-1-carboxamide
1-(4-methoxyphenyl)-N-[(2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridin-4a-yl)methyl]cyclopropane-1-carboxamide
Compound characteristics
| Compound ID: | S571-0137 |
| Compound Name: | 1-(4-methoxyphenyl)-N-[(2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridin-4a-yl)methyl]cyclopropane-1-carboxamide |
| Molecular Weight: | 340.42 |
| Molecular Formula: | C20 H24 N2 O3 |
| Smiles: | COc1ccc(cc1)C1(CC1)C(NCC12CCC=C2NC(CC1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.3746 |
| logD: | 2.3746 |
| logSw: | -2.7688 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 57.967 |
| InChI Key: | YZKBJWSEIXIGGM-IBGZPJMESA-N |