N-[(3,5-dimethoxyphenyl)methyl]-2-(2-oxo-2,4,5,6,7,7a-hexahydro-1H-indol-3-yl)acetamide
Chemical Structure Depiction of
N-[(3,5-dimethoxyphenyl)methyl]-2-(2-oxo-2,4,5,6,7,7a-hexahydro-1H-indol-3-yl)acetamide
N-[(3,5-dimethoxyphenyl)methyl]-2-(2-oxo-2,4,5,6,7,7a-hexahydro-1H-indol-3-yl)acetamide
Compound characteristics
| Compound ID: | S579-0064 |
| Compound Name: | N-[(3,5-dimethoxyphenyl)methyl]-2-(2-oxo-2,4,5,6,7,7a-hexahydro-1H-indol-3-yl)acetamide |
| Molecular Weight: | 344.41 |
| Molecular Formula: | C19 H24 N2 O4 |
| Smiles: | COc1cc(CNC(CC2=C3CCCCC3NC2=O)=O)cc(c1)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.0395 |
| logD: | 2.0395 |
| logSw: | -2.3156 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 65.572 |
| InChI Key: | RPGLBDHVHHPCJA-QGZVFWFLSA-N |