1-benzyl-3-{2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl}azepan-2-one
Chemical Structure Depiction of
1-benzyl-3-{2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl}azepan-2-one
1-benzyl-3-{2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl}azepan-2-one
Compound characteristics
| Compound ID: | S581-0881 |
| Compound Name: | 1-benzyl-3-{2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl}azepan-2-one |
| Molecular Weight: | 439.98 |
| Molecular Formula: | C25 H30 Cl N3 O2 |
| Smiles: | C1CCN(Cc2ccccc2)C(C(C1)CC(N1CCN(CC1)c1cccc(c1)[Cl])=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8559 |
| logD: | 3.8559 |
| logSw: | -4.2054 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 36.569 |
| InChI Key: | NVTMHSRQSBGHCY-OAQYLSRUSA-N |