N-(2-methylpropyl)-N-(oxan-4-yl)-1-(phenylmethanesulfonyl)azetidin-3-amine
Chemical Structure Depiction of
N-(2-methylpropyl)-N-(oxan-4-yl)-1-(phenylmethanesulfonyl)azetidin-3-amine
N-(2-methylpropyl)-N-(oxan-4-yl)-1-(phenylmethanesulfonyl)azetidin-3-amine
Compound characteristics
| Compound ID: | S591-0156 |
| Compound Name: | N-(2-methylpropyl)-N-(oxan-4-yl)-1-(phenylmethanesulfonyl)azetidin-3-amine |
| Molecular Weight: | 366.52 |
| Molecular Formula: | C19 H30 N2 O3 S |
| Smiles: | CC(C)CN(C1CCOCC1)C1CN(C1)S(Cc1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5873 |
| logD: | 0.8669 |
| logSw: | -2.7399 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 41.851 |
| InChI Key: | VEDRQWSMKBRPOL-UHFFFAOYSA-N |