N-[1-(4-fluorobenzene-1-sulfonyl)azetidin-3-yl]-N-(oxan-4-yl)methanesulfonamide
					Chemical Structure Depiction of
N-[1-(4-fluorobenzene-1-sulfonyl)azetidin-3-yl]-N-(oxan-4-yl)methanesulfonamide
			N-[1-(4-fluorobenzene-1-sulfonyl)azetidin-3-yl]-N-(oxan-4-yl)methanesulfonamide
Compound characteristics
| Compound ID: | S591-0769 | 
| Compound Name: | N-[1-(4-fluorobenzene-1-sulfonyl)azetidin-3-yl]-N-(oxan-4-yl)methanesulfonamide | 
| Molecular Weight: | 392.47 | 
| Molecular Formula: | C15 H21 F N2 O5 S2 | 
| Smiles: | CS(N(C1CCOCC1)C1CN(C1)S(c1ccc(cc1)F)(=O)=O)(=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 1.104 | 
| logD: | 1.104 | 
| logSw: | -2.3089 | 
| Hydrogen bond acceptors count: | 11 | 
| Polar surface area: | 71.406 | 
| InChI Key: | QLDLPYZDHSCEIC-UHFFFAOYSA-N | 
 
				 
				