N-(oxan-4-yl)-N-[1-(thiophene-3-carbonyl)azetidin-3-yl]methanesulfonamide
Chemical Structure Depiction of
N-(oxan-4-yl)-N-[1-(thiophene-3-carbonyl)azetidin-3-yl]methanesulfonamide
N-(oxan-4-yl)-N-[1-(thiophene-3-carbonyl)azetidin-3-yl]methanesulfonamide
Compound characteristics
| Compound ID: | S591-0821 |
| Compound Name: | N-(oxan-4-yl)-N-[1-(thiophene-3-carbonyl)azetidin-3-yl]methanesulfonamide |
| Molecular Weight: | 344.45 |
| Molecular Formula: | C14 H20 N2 O4 S2 |
| Smiles: | CS(N(C1CCOCC1)C1CN(C1)C(c1ccsc1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.6477 |
| logD: | 0.6477 |
| logSw: | -2.0042 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 57.361 |
| InChI Key: | OVBLYPNCIOTGLX-UHFFFAOYSA-N |