N-[1-(1-ethyl-1H-pyrazole-3-carbonyl)azetidin-3-yl]-N-(oxan-4-yl)methanesulfonamide
Chemical Structure Depiction of
N-[1-(1-ethyl-1H-pyrazole-3-carbonyl)azetidin-3-yl]-N-(oxan-4-yl)methanesulfonamide
N-[1-(1-ethyl-1H-pyrazole-3-carbonyl)azetidin-3-yl]-N-(oxan-4-yl)methanesulfonamide
Compound characteristics
| Compound ID: | S591-0912 |
| Compound Name: | N-[1-(1-ethyl-1H-pyrazole-3-carbonyl)azetidin-3-yl]-N-(oxan-4-yl)methanesulfonamide |
| Molecular Weight: | 356.44 |
| Molecular Formula: | C15 H24 N4 O4 S |
| Smiles: | CCn1ccc(C(N2CC(C2)N(C2CCOCC2)S(C)(=O)=O)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | -0.232 |
| logD: | -0.232 |
| logSw: | -1.7579 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 70.728 |
| InChI Key: | PYXODPDBYZXQRB-UHFFFAOYSA-N |