1-(2-{5-[(4-fluorophenoxy)methyl]-1,2,4-oxadiazol-3-yl}piperidin-1-yl)-2-(3-methylphenyl)ethan-1-one
Chemical Structure Depiction of
1-(2-{5-[(4-fluorophenoxy)methyl]-1,2,4-oxadiazol-3-yl}piperidin-1-yl)-2-(3-methylphenyl)ethan-1-one
1-(2-{5-[(4-fluorophenoxy)methyl]-1,2,4-oxadiazol-3-yl}piperidin-1-yl)-2-(3-methylphenyl)ethan-1-one
Compound characteristics
| Compound ID: | S595-0588 |
| Compound Name: | 1-(2-{5-[(4-fluorophenoxy)methyl]-1,2,4-oxadiazol-3-yl}piperidin-1-yl)-2-(3-methylphenyl)ethan-1-one |
| Molecular Weight: | 409.46 |
| Molecular Formula: | C23 H24 F N3 O3 |
| Smiles: | Cc1cccc(CC(N2CCCCC2c2nc(COc3ccc(cc3)F)on2)=O)c1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6481 |
| logD: | 4.6481 |
| logSw: | -4.5296 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 54.624 |
| InChI Key: | BDIYDFZTUYEOQC-FQEVSTJZSA-N |