2-(5-{[(4-fluorophenyl)methoxy]methyl}-1,2,4-oxadiazol-3-yl)-N-propylpiperidine-1-carboxamide
Chemical Structure Depiction of
2-(5-{[(4-fluorophenyl)methoxy]methyl}-1,2,4-oxadiazol-3-yl)-N-propylpiperidine-1-carboxamide
2-(5-{[(4-fluorophenyl)methoxy]methyl}-1,2,4-oxadiazol-3-yl)-N-propylpiperidine-1-carboxamide
Compound characteristics
| Compound ID: | S595-0865 |
| Compound Name: | 2-(5-{[(4-fluorophenyl)methoxy]methyl}-1,2,4-oxadiazol-3-yl)-N-propylpiperidine-1-carboxamide |
| Molecular Weight: | 376.43 |
| Molecular Formula: | C19 H25 F N4 O3 |
| Smiles: | CCCNC(N1CCCCC1c1nc(COCc2ccc(cc2)F)on1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.484 |
| logD: | 3.484 |
| logSw: | -3.5241 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.342 |
| InChI Key: | OQXZPHSOKRBDHN-INIZCTEOSA-N |