4-[(2S,4R)-2-(cyclohexylcarbamoyl)-4-hydroxypyrrolidin-1-yl]-N-(3-fluoro-2-methylphenyl)piperidine-1-carboxamide
Chemical Structure Depiction of
4-[(2S,4R)-2-(cyclohexylcarbamoyl)-4-hydroxypyrrolidin-1-yl]-N-(3-fluoro-2-methylphenyl)piperidine-1-carboxamide
4-[(2S,4R)-2-(cyclohexylcarbamoyl)-4-hydroxypyrrolidin-1-yl]-N-(3-fluoro-2-methylphenyl)piperidine-1-carboxamide
Compound characteristics
| Compound ID: | S596-2080 |
| Compound Name: | 4-[(2S,4R)-2-(cyclohexylcarbamoyl)-4-hydroxypyrrolidin-1-yl]-N-(3-fluoro-2-methylphenyl)piperidine-1-carboxamide |
| Molecular Weight: | 446.56 |
| Molecular Formula: | C24 H35 F N4 O3 |
| Smiles: | Cc1c(cccc1F)NC(N1CCC(CC1)N1C[C@@H](C[C@H]1C(NC1CCCCC1)=O)O)=O |
| Stereo: | ABSOLUTE |
| logP: | 3.4389 |
| logD: | 2.6247 |
| logSw: | -3.4101 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 67.957 |
| InChI Key: | RLMKNHLIVUKTHK-UGKGYDQZSA-N |