(4R)-1-{1-[(4-ethoxyphenyl)acetyl]piperidin-4-yl}-4-hydroxy-N-(2-methoxyethyl)-L-prolinamide
Chemical Structure Depiction of
(4R)-1-{1-[(4-ethoxyphenyl)acetyl]piperidin-4-yl}-4-hydroxy-N-(2-methoxyethyl)-L-prolinamide
(4R)-1-{1-[(4-ethoxyphenyl)acetyl]piperidin-4-yl}-4-hydroxy-N-(2-methoxyethyl)-L-prolinamide
Compound characteristics
| Compound ID: | S596-2259 |
| Compound Name: | (4R)-1-{1-[(4-ethoxyphenyl)acetyl]piperidin-4-yl}-4-hydroxy-N-(2-methoxyethyl)-L-prolinamide |
| Molecular Weight: | 433.55 |
| Molecular Formula: | C23 H35 N3 O5 |
| Smiles: | CCOc1ccc(CC(N2CCC(CC2)N2C[C@@H](C[C@H]2C(NCCOC)=O)O)=O)cc1 |
| Stereo: | ABSOLUTE |
| logP: | 1.3562 |
| logD: | 1.0879 |
| logSw: | -1.9753 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 75.161 |
| InChI Key: | HRJKGWJBABUVLP-CTNGQTDRSA-N |