2-{3-[2-(benzyloxy)ethyl]-1,2,4-oxadiazol-5-yl}-1-(phenylmethanesulfonyl)piperidine
Chemical Structure Depiction of
2-{3-[2-(benzyloxy)ethyl]-1,2,4-oxadiazol-5-yl}-1-(phenylmethanesulfonyl)piperidine
2-{3-[2-(benzyloxy)ethyl]-1,2,4-oxadiazol-5-yl}-1-(phenylmethanesulfonyl)piperidine
Compound characteristics
| Compound ID: | S614-0195 |
| Compound Name: | 2-{3-[2-(benzyloxy)ethyl]-1,2,4-oxadiazol-5-yl}-1-(phenylmethanesulfonyl)piperidine |
| Molecular Weight: | 441.55 |
| Molecular Formula: | C23 H27 N3 O4 S |
| Smiles: | C1CCN(C(C1)c1nc(CCOCc2ccccc2)no1)S(Cc1ccccc1)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.6254 |
| logD: | 3.6254 |
| logSw: | -3.7153 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 73.064 |
| InChI Key: | BBTKJAPYSQUSNG-NRFANRHFSA-N |