N-benzyl-2-(3-{2-[(oxan-4-yl)methoxy]ethyl}-1,2,4-oxadiazol-5-yl)piperidine-1-carboxamide
Chemical Structure Depiction of
N-benzyl-2-(3-{2-[(oxan-4-yl)methoxy]ethyl}-1,2,4-oxadiazol-5-yl)piperidine-1-carboxamide
N-benzyl-2-(3-{2-[(oxan-4-yl)methoxy]ethyl}-1,2,4-oxadiazol-5-yl)piperidine-1-carboxamide
Compound characteristics
| Compound ID: | S614-1158 |
| Compound Name: | N-benzyl-2-(3-{2-[(oxan-4-yl)methoxy]ethyl}-1,2,4-oxadiazol-5-yl)piperidine-1-carboxamide |
| Molecular Weight: | 428.53 |
| Molecular Formula: | C23 H32 N4 O4 |
| Smiles: | C1CCN(C(C1)c1nc(CCOCC2CCOCC2)no1)C(NCc1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.1611 |
| logD: | 3.1611 |
| logSw: | -3.2863 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 75.574 |
| InChI Key: | GOJVIGUXVDJADW-FQEVSTJZSA-N |