3-{3-[2-(benzyloxy)ethyl]-1,2,4-oxadiazol-5-yl}-N-(2-fluorophenyl)pyrrolidine-1-carboxamide
Chemical Structure Depiction of
3-{3-[2-(benzyloxy)ethyl]-1,2,4-oxadiazol-5-yl}-N-(2-fluorophenyl)pyrrolidine-1-carboxamide
3-{3-[2-(benzyloxy)ethyl]-1,2,4-oxadiazol-5-yl}-N-(2-fluorophenyl)pyrrolidine-1-carboxamide
Compound characteristics
| Compound ID: | S615-0092 |
| Compound Name: | 3-{3-[2-(benzyloxy)ethyl]-1,2,4-oxadiazol-5-yl}-N-(2-fluorophenyl)pyrrolidine-1-carboxamide |
| Molecular Weight: | 410.45 |
| Molecular Formula: | C22 H23 F N4 O3 |
| Smiles: | C1CN(CC1c1nc(CCOCc2ccccc2)no1)C(Nc1ccccc1F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9171 |
| logD: | 3.917 |
| logSw: | -3.9691 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.058 |
| InChI Key: | OUAWWYQJAQMWQP-QGZVFWFLSA-N |