N-[rel-(3R,4R)-1-[(4-fluorophenoxy)acetyl]-4-(hydroxymethyl)piperidin-3-yl]-2-methoxyacetamide
Chemical Structure Depiction of
N-[rel-(3R,4R)-1-[(4-fluorophenoxy)acetyl]-4-(hydroxymethyl)piperidin-3-yl]-2-methoxyacetamide
N-[rel-(3R,4R)-1-[(4-fluorophenoxy)acetyl]-4-(hydroxymethyl)piperidin-3-yl]-2-methoxyacetamide
Compound characteristics
| Compound ID: | S617-0237 |
| Compound Name: | N-[rel-(3R,4R)-1-[(4-fluorophenoxy)acetyl]-4-(hydroxymethyl)piperidin-3-yl]-2-methoxyacetamide |
| Molecular Weight: | 354.38 |
| Molecular Formula: | C17 H23 F N2 O5 |
| Smiles: | COCC(N[C@@H]1CN(CC[C@@H]1CO)C(COc1ccc(cc1)F)=O)=O |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | -0.2465 |
| logD: | -0.2465 |
| logSw: | -1.6276 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 73.726 |
| InChI Key: | FMWRJNHBABWNPE-DOMZBBRYSA-N |