2-methyl-8-(1,3-oxazole-4-carbonyl)-N-[(pyridin-2-yl)methyl]-2,8-diazaspiro[4.5]decane-3-carboxamide
Chemical Structure Depiction of
2-methyl-8-(1,3-oxazole-4-carbonyl)-N-[(pyridin-2-yl)methyl]-2,8-diazaspiro[4.5]decane-3-carboxamide
2-methyl-8-(1,3-oxazole-4-carbonyl)-N-[(pyridin-2-yl)methyl]-2,8-diazaspiro[4.5]decane-3-carboxamide
Compound characteristics
| Compound ID: | S651-1262 |
| Compound Name: | 2-methyl-8-(1,3-oxazole-4-carbonyl)-N-[(pyridin-2-yl)methyl]-2,8-diazaspiro[4.5]decane-3-carboxamide |
| Molecular Weight: | 383.45 |
| Molecular Formula: | C20 H25 N5 O3 |
| Smiles: | CN1CC2(CCN(CC2)C(c2cocn2)=O)CC1C(NCc1ccccn1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | -0.3057 |
| logD: | -0.3909 |
| logSw: | -1.6402 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.779 |
| InChI Key: | FGVKDCPPJILSEO-QGZVFWFLSA-N |