(furan-2-yl)[rel-(2R,3S)-3-phenyl-2-{[(pyridin-2-yl)oxy]methyl}morpholin-4-yl]methanone
Chemical Structure Depiction of
(furan-2-yl)[rel-(2R,3S)-3-phenyl-2-{[(pyridin-2-yl)oxy]methyl}morpholin-4-yl]methanone
(furan-2-yl)[rel-(2R,3S)-3-phenyl-2-{[(pyridin-2-yl)oxy]methyl}morpholin-4-yl]methanone
Compound characteristics
| Compound ID: | S683-1112 |
| Compound Name: | (furan-2-yl)[rel-(2R,3S)-3-phenyl-2-{[(pyridin-2-yl)oxy]methyl}morpholin-4-yl]methanone |
| Molecular Weight: | 364.4 |
| Molecular Formula: | C21 H20 N2 O4 |
| Smiles: | C1CO[C@@H](COc2ccccn2)[C@H](c2ccccc2)N1C(c1ccco1)=O |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 3.1765 |
| logD: | 3.1765 |
| logSw: | -3.0503 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 49.599 |
| InChI Key: | PAMYNMDEZDKCOU-UYAOXDASSA-N |