[4-(2,5-dimethyl-1H-pyrrol-1-yl)phenyl]{4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1-oxa-9-azaspiro[5.5]undecan-9-yl}methanone
Chemical Structure Depiction of
[4-(2,5-dimethyl-1H-pyrrol-1-yl)phenyl]{4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1-oxa-9-azaspiro[5.5]undecan-9-yl}methanone
[4-(2,5-dimethyl-1H-pyrrol-1-yl)phenyl]{4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1-oxa-9-azaspiro[5.5]undecan-9-yl}methanone
Compound characteristics
| Compound ID: | S687-0106 |
| Compound Name: | [4-(2,5-dimethyl-1H-pyrrol-1-yl)phenyl]{4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1-oxa-9-azaspiro[5.5]undecan-9-yl}methanone |
| Molecular Weight: | 448.56 |
| Molecular Formula: | C26 H32 N4 O3 |
| Smiles: | Cc1nc(CC2CCOC3(CCN(CC3)C(c3ccc(cc3)n3c(C)ccc3C)=O)C2)on1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2972 |
| logD: | 3.2972 |
| logSw: | -3.2046 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 57.333 |
| InChI Key: | ZDBBSMKDHIZCOT-NRFANRHFSA-N |