2-(3-methoxyphenyl)-1-(4-{[3-(pyrazin-2-yl)-1,2,4-oxadiazol-5-yl]methyl}-1-oxa-9-azaspiro[5.5]undecan-9-yl)ethan-1-one
Chemical Structure Depiction of
2-(3-methoxyphenyl)-1-(4-{[3-(pyrazin-2-yl)-1,2,4-oxadiazol-5-yl]methyl}-1-oxa-9-azaspiro[5.5]undecan-9-yl)ethan-1-one
2-(3-methoxyphenyl)-1-(4-{[3-(pyrazin-2-yl)-1,2,4-oxadiazol-5-yl]methyl}-1-oxa-9-azaspiro[5.5]undecan-9-yl)ethan-1-one
Compound characteristics
| Compound ID: | S687-2189 |
| Compound Name: | 2-(3-methoxyphenyl)-1-(4-{[3-(pyrazin-2-yl)-1,2,4-oxadiazol-5-yl]methyl}-1-oxa-9-azaspiro[5.5]undecan-9-yl)ethan-1-one |
| Molecular Weight: | 463.54 |
| Molecular Formula: | C25 H29 N5 O4 |
| Smiles: | COc1cccc(CC(N2CCC3(CC2)CC(CCO3)Cc2nc(c3cnccn3)no2)=O)c1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.8154 |
| logD: | 2.8152 |
| logSw: | -2.9394 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 80.142 |
| InChI Key: | QHSGBKJAFWYLCF-IBGZPJMESA-N |