4-[(4-carbamoylphenyl)methyl]-N-phenylpiperidine-1-carboxamide
Chemical Structure Depiction of
4-[(4-carbamoylphenyl)methyl]-N-phenylpiperidine-1-carboxamide
4-[(4-carbamoylphenyl)methyl]-N-phenylpiperidine-1-carboxamide
Compound characteristics
| Compound ID: | S690-0237 |
| Compound Name: | 4-[(4-carbamoylphenyl)methyl]-N-phenylpiperidine-1-carboxamide |
| Molecular Weight: | 337.42 |
| Molecular Formula: | C20 H23 N3 O2 |
| Smiles: | C1CN(CCC1Cc1ccc(cc1)C(N)=O)C(Nc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8872 |
| logD: | 2.8872 |
| logSw: | -3.4549 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 59.495 |
| InChI Key: | ZCNHUEXKFXNWQI-UHFFFAOYSA-N |