N-benzyl-3-[(2,5-dimethyl-1H-imidazol-1-yl)methyl]piperidine-1-carboxamide
Chemical Structure Depiction of
N-benzyl-3-[(2,5-dimethyl-1H-imidazol-1-yl)methyl]piperidine-1-carboxamide
N-benzyl-3-[(2,5-dimethyl-1H-imidazol-1-yl)methyl]piperidine-1-carboxamide
Compound characteristics
| Compound ID: | S693-1522 |
| Compound Name: | N-benzyl-3-[(2,5-dimethyl-1H-imidazol-1-yl)methyl]piperidine-1-carboxamide |
| Molecular Weight: | 326.44 |
| Molecular Formula: | C19 H26 N4 O |
| Smiles: | Cc1cnc(C)n1CC1CCCN(C1)C(NCc1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.3602 |
| logD: | 1.0207 |
| logSw: | -2.5418 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.925 |
| InChI Key: | HMCURBOVJNWDKG-SFHVURJKSA-N |