(4S)-1-[(3-methylthiophen-2-yl)methyl]-4-phenoxy-L-prolinamide
Chemical Structure Depiction of
(4S)-1-[(3-methylthiophen-2-yl)methyl]-4-phenoxy-L-prolinamide
(4S)-1-[(3-methylthiophen-2-yl)methyl]-4-phenoxy-L-prolinamide
Compound characteristics
| Compound ID: | S720-2184 |
| Compound Name: | (4S)-1-[(3-methylthiophen-2-yl)methyl]-4-phenoxy-L-prolinamide |
| Molecular Weight: | 316.42 |
| Molecular Formula: | C17 H20 N2 O2 S |
| Smiles: | Cc1ccsc1CN1C[C@H](C[C@H]1C(N)=O)Oc1ccccc1 |
| Stereo: | ABSOLUTE |
| logP: | 2.4735 |
| logD: | 2.4733 |
| logSw: | -2.4607 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 45.469 |
| InChI Key: | JSSUUEASUVNRBH-CABCVRRESA-N |