2-methyl-1-[4-({4-[(morpholin-4-yl)methyl]phenyl}methyl)piperidin-1-yl]propan-1-one
Chemical Structure Depiction of
2-methyl-1-[4-({4-[(morpholin-4-yl)methyl]phenyl}methyl)piperidin-1-yl]propan-1-one
2-methyl-1-[4-({4-[(morpholin-4-yl)methyl]phenyl}methyl)piperidin-1-yl]propan-1-one
Compound characteristics
| Compound ID: | S722-0695 |
| Compound Name: | 2-methyl-1-[4-({4-[(morpholin-4-yl)methyl]phenyl}methyl)piperidin-1-yl]propan-1-one |
| Molecular Weight: | 344.5 |
| Molecular Formula: | C21 H32 N2 O2 |
| Smiles: | CC(C)C(N1CCC(CC1)Cc1ccc(CN2CCOCC2)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0659 |
| logD: | 2.8733 |
| logSw: | -2.9832 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 28.5278 |
| InChI Key: | HDBNISJGWNYPJA-UHFFFAOYSA-N |