(6-methoxypyridin-3-yl)[4-({4-[(4-methylpiperazin-1-yl)methyl]phenyl}methyl)piperidin-1-yl]methanone
Chemical Structure Depiction of
(6-methoxypyridin-3-yl)[4-({4-[(4-methylpiperazin-1-yl)methyl]phenyl}methyl)piperidin-1-yl]methanone
(6-methoxypyridin-3-yl)[4-({4-[(4-methylpiperazin-1-yl)methyl]phenyl}methyl)piperidin-1-yl]methanone
Compound characteristics
| Compound ID: | S722-0964 |
| Compound Name: | (6-methoxypyridin-3-yl)[4-({4-[(4-methylpiperazin-1-yl)methyl]phenyl}methyl)piperidin-1-yl]methanone |
| Molecular Weight: | 422.57 |
| Molecular Formula: | C25 H34 N4 O2 |
| Smiles: | CN1CCN(CC1)Cc1ccc(CC2CCN(CC2)C(c2ccc(nc2)OC)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 2.7912 |
| logD: | 1.9923 |
| logSw: | -2.7986 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 40.406 |
| InChI Key: | WLGHXKUEGQYSMJ-UHFFFAOYSA-N |