N-[(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]-1-(2-hydroxyethyl)-6-oxaspiro[2.5]octane-1-carboxamide
Chemical Structure Depiction of
N-[(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]-1-(2-hydroxyethyl)-6-oxaspiro[2.5]octane-1-carboxamide
N-[(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]-1-(2-hydroxyethyl)-6-oxaspiro[2.5]octane-1-carboxamide
Compound characteristics
| Compound ID: | S728-0132 |
| Compound Name: | N-[(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]-1-(2-hydroxyethyl)-6-oxaspiro[2.5]octane-1-carboxamide |
| Molecular Weight: | 335.45 |
| Molecular Formula: | C18 H29 N3 O3 |
| Smiles: | CCn1c(C)c(CNC(C2(CCO)CC23CCOCC3)=O)c(C)n1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.4985 |
| logD: | 0.4985 |
| logSw: | -0.8061 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.938 |
| InChI Key: | FTNDVUKQFMGBJD-GOSISDBHSA-N |