1-(2-hydroxyethyl)-N-[3-(piperidin-1-yl)propyl]-6-oxaspiro[2.5]octane-1-carboxamide
Chemical Structure Depiction of
1-(2-hydroxyethyl)-N-[3-(piperidin-1-yl)propyl]-6-oxaspiro[2.5]octane-1-carboxamide
1-(2-hydroxyethyl)-N-[3-(piperidin-1-yl)propyl]-6-oxaspiro[2.5]octane-1-carboxamide
Compound characteristics
| Compound ID: | S728-0162 |
| Compound Name: | 1-(2-hydroxyethyl)-N-[3-(piperidin-1-yl)propyl]-6-oxaspiro[2.5]octane-1-carboxamide |
| Molecular Weight: | 324.46 |
| Molecular Formula: | C18 H32 N2 O3 |
| Smiles: | C1CCN(CC1)CCCNC(C1(CCO)CC12CCOCC2)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.5156 |
| logD: | -2.1385 |
| logSw: | -0.5213 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 53.484 |
| InChI Key: | ACEFVTBZLQQYKX-GOSISDBHSA-N |