N-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazecan-1-yl)ethyl]-2,3-dihydro-1H-indene-5-sulfonamide
Chemical Structure Depiction of
N-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazecan-1-yl)ethyl]-2,3-dihydro-1H-indene-5-sulfonamide
N-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazecan-1-yl)ethyl]-2,3-dihydro-1H-indene-5-sulfonamide
Compound characteristics
| Compound ID: | S734-1071 |
| Compound Name: | N-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazecan-1-yl)ethyl]-2,3-dihydro-1H-indene-5-sulfonamide |
| Molecular Weight: | 469.6 |
| Molecular Formula: | C25 H31 N3 O4 S |
| Smiles: | C1CCNC(CC(c2ccccc2)N(CC1)C(CNS(c1ccc2CCCc2c1)(=O)=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.8432 |
| logD: | 2.8416 |
| logSw: | -3.4165 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 83.453 |
| InChI Key: | UMPYPSOXFWOUFU-QHCPKHFHSA-N |