3-cyclopentyl-1-[1-(3-fluorophenyl)-3-methoxy-1,7-diazaspiro[3.5]nonan-7-yl]propan-1-one
Chemical Structure Depiction of
3-cyclopentyl-1-[1-(3-fluorophenyl)-3-methoxy-1,7-diazaspiro[3.5]nonan-7-yl]propan-1-one
3-cyclopentyl-1-[1-(3-fluorophenyl)-3-methoxy-1,7-diazaspiro[3.5]nonan-7-yl]propan-1-one
Compound characteristics
| Compound ID: | S736-0231 |
| Compound Name: | 3-cyclopentyl-1-[1-(3-fluorophenyl)-3-methoxy-1,7-diazaspiro[3.5]nonan-7-yl]propan-1-one |
| Molecular Weight: | 374.5 |
| Molecular Formula: | C22 H31 F N2 O2 |
| Smiles: | COC1CN(c2cccc(c2)F)C12CCN(CC2)C(CCC1CCCC1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4282 |
| logD: | 3.4143 |
| logSw: | -3.8246 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 26.6677 |
| InChI Key: | SABIFETVFQLWKN-HXUWFJFHSA-N |