rel-(3R,4S)-1-{1-[(2,4-difluorophenyl)methyl]piperidin-4-yl}-3-(2-methoxyethoxy)-4-(pyridin-4-yl)azetidin-2-one
Chemical Structure Depiction of
rel-(3R,4S)-1-{1-[(2,4-difluorophenyl)methyl]piperidin-4-yl}-3-(2-methoxyethoxy)-4-(pyridin-4-yl)azetidin-2-one
rel-(3R,4S)-1-{1-[(2,4-difluorophenyl)methyl]piperidin-4-yl}-3-(2-methoxyethoxy)-4-(pyridin-4-yl)azetidin-2-one
Compound characteristics
| Compound ID: | S741-0343 |
| Compound Name: | rel-(3R,4S)-1-{1-[(2,4-difluorophenyl)methyl]piperidin-4-yl}-3-(2-methoxyethoxy)-4-(pyridin-4-yl)azetidin-2-one |
| Molecular Weight: | 431.48 |
| Molecular Formula: | C23 H27 F2 N3 O3 |
| Smiles: | COCCO[C@H]1C(N(C2CCN(CC2)Cc2ccc(cc2F)F)[C@H]1c1ccncc1)=O |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 1.8317 |
| logD: | 1.2514 |
| logSw: | -1.8242 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 43.604 |
| InChI Key: | JJLCTNFFHBZENA-FCHUYYIVSA-N |