N-[2-(2-cyclopropyl-5-methyl-1H-imidazol-1-yl)ethyl]-2,4-dimethoxybenzamide
Chemical Structure Depiction of
N-[2-(2-cyclopropyl-5-methyl-1H-imidazol-1-yl)ethyl]-2,4-dimethoxybenzamide
N-[2-(2-cyclopropyl-5-methyl-1H-imidazol-1-yl)ethyl]-2,4-dimethoxybenzamide
Compound characteristics
| Compound ID: | S751-0308 |
| Compound Name: | N-[2-(2-cyclopropyl-5-methyl-1H-imidazol-1-yl)ethyl]-2,4-dimethoxybenzamide |
| Molecular Weight: | 329.4 |
| Molecular Formula: | C18 H23 N3 O3 |
| Smiles: | Cc1cnc(C2CC2)n1CCNC(c1ccc(cc1OC)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7053 |
| logD: | -0.7855 |
| logSw: | -3.0751 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.354 |
| InChI Key: | RCNHCPBAEBWVIH-UHFFFAOYSA-N |