N-[2-(4-{[1-(1-methyl-1H-pyrazole-4-carbonyl)piperidin-4-yl]methyl}phenyl)ethyl]methanesulfonamide
Chemical Structure Depiction of
N-[2-(4-{[1-(1-methyl-1H-pyrazole-4-carbonyl)piperidin-4-yl]methyl}phenyl)ethyl]methanesulfonamide
N-[2-(4-{[1-(1-methyl-1H-pyrazole-4-carbonyl)piperidin-4-yl]methyl}phenyl)ethyl]methanesulfonamide
Compound characteristics
| Compound ID: | S752-0110 |
| Compound Name: | N-[2-(4-{[1-(1-methyl-1H-pyrazole-4-carbonyl)piperidin-4-yl]methyl}phenyl)ethyl]methanesulfonamide |
| Molecular Weight: | 404.53 |
| Molecular Formula: | C20 H28 N4 O3 S |
| Smiles: | Cn1cc(cn1)C(N1CCC(CC1)Cc1ccc(CCNS(C)(=O)=O)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.4327 |
| logD: | 1.4327 |
| logSw: | -2.3361 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74.242 |
| InChI Key: | IQLSJARHUIHTMO-UHFFFAOYSA-N |