rel-(3R,4S)-3-methoxy-1-[(4-methoxyphenyl)methyl]-4-[1-(thiophene-2-carbonyl)-1,2,3,6-tetrahydropyridin-4-yl]azetidin-2-one
Chemical Structure Depiction of
rel-(3R,4S)-3-methoxy-1-[(4-methoxyphenyl)methyl]-4-[1-(thiophene-2-carbonyl)-1,2,3,6-tetrahydropyridin-4-yl]azetidin-2-one
rel-(3R,4S)-3-methoxy-1-[(4-methoxyphenyl)methyl]-4-[1-(thiophene-2-carbonyl)-1,2,3,6-tetrahydropyridin-4-yl]azetidin-2-one
Compound characteristics
| Compound ID: | S756-0010 |
| Compound Name: | rel-(3R,4S)-3-methoxy-1-[(4-methoxyphenyl)methyl]-4-[1-(thiophene-2-carbonyl)-1,2,3,6-tetrahydropyridin-4-yl]azetidin-2-one |
| Molecular Weight: | 412.51 |
| Molecular Formula: | C22 H24 N2 O4 S |
| Smiles: | COc1ccc(CN2C([C@@H]([C@@H]2C2CCN(CC=2)C(c2cccs2)=O)OC)=O)cc1 |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 2.4488 |
| logD: | 2.4488 |
| logSw: | -2.5195 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 48.408 |
| InChI Key: | UFFAVTFJJZUCQS-WOJBJXKFSA-N |