cyclohexyl{4-[rel-(2R,3R)-3-methoxy-2-(pyridin-3-yl)azetidin-1-yl]piperidin-1-yl}methanone
Chemical Structure Depiction of
cyclohexyl{4-[rel-(2R,3R)-3-methoxy-2-(pyridin-3-yl)azetidin-1-yl]piperidin-1-yl}methanone
cyclohexyl{4-[rel-(2R,3R)-3-methoxy-2-(pyridin-3-yl)azetidin-1-yl]piperidin-1-yl}methanone
Compound characteristics
| Compound ID: | S757-0001 |
| Compound Name: | cyclohexyl{4-[rel-(2R,3R)-3-methoxy-2-(pyridin-3-yl)azetidin-1-yl]piperidin-1-yl}methanone |
| Molecular Weight: | 357.5 |
| Molecular Formula: | C21 H31 N3 O2 |
| Smiles: | CO[C@H]1CN(C2CCN(CC2)C(C2CCCCC2)=O)[C@H]1c1cccnc1 |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 2.6552 |
| logD: | 2.0976 |
| logSw: | -2.3117 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 36.201 |
| InChI Key: | WCQVSYSPDTXWJX-VQTJNVASSA-N |